C16H13F2N3O3 — CID 71585757
5-(2,4-difluorophenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione (PubChem CID 71585757) has the molecular formula C16H13F2N3O3 and a molecular weight of 333.29 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-difluorophenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71585757 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-(2,4-difluorophenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccn(CC2(c3ccc(F)cc3F)NC(=O)NC2=O)c1=O |
| InChI | InChI=1S/C16H13F2N3O3/c1-9-3-2-6-21(13(9)22)8-16(14(23)19-15(24)20-16)11-5-4-10(17)7-12(11)18/h2-7H,8H2,1H3,(H2,19,20,23,24) |
| InChIKey | MSMVDGFEPUUPPE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|