C27H31N5O3 — CID 71585878
N-[[5-(2-methylpropyl)-1-phenylpyrazol-3-yl]methyl]-2-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide (PubChem CID 71585878) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[[5-(2-methylpropyl)-1-phenylpyrazol-3-yl]methyl]-2-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide.
| Compound Name | N-[[5-(2-methylpropyl)-1-phenylpyrazol-3-yl]methyl]-2-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 71585878 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-[[5-(2-methylpropyl)-1-phenylpyrazol-3-yl]methyl]-2-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide |
| SMILES | CC(C)Cc1cc(CNC(=O)CN2CC=C(c3ccccc3[N+](=O)[O-])CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H31N5O3/c1-20(2)16-24-17-22(29-31(24)23-8-4-3-5-9-23)18-28-27(33)19-30-14-12-21(13-15-30)25-10-6-7-11-26(25)32(34)35/h3-12,17,20H,13-16,18-19H2,1-2H3,(H,28,33) |
| InChIKey | XOTQDSQKFMISTM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|