C24H45N7O4 — CID 71585888
N-[(3S,6S,9S)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclohexadec-9-yl]-2-methylpropanamide (PubChem CID 71585888) has the molecular formula C24H45N7O4 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[(3S,6S,9S)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclohexadec-9-yl]-2-methylpropanamide.
| Compound Name | N-[(3S,6S,9S)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclohexadec-9-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71585888 |
| Molecular Formula | C24H45N7O4 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | N-[(3S,6S,9S)-6-[3-(diaminomethylideneamino)propyl]-3-ethyl-9-methyl-2,5,8-trioxo-1,4,7-triazacyclohexadec-9-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@](C)(NC(=O)C(C)C)CCCCCCCNC1=O |
| InChI | InChI=1S/C24H45N7O4/c1-5-17-20(33)27-14-10-8-6-7-9-13-24(4,31-19(32)16(2)3)22(35)30-18(21(34)29-17)12-11-15-28-23(25)26/h16-18H,5-15H2,1-4H3,(H,27,33)(H,29,34)(H,30,35)(H,31,32)(H4,25,26,28)/t17-,18-,24-/m0/s1 |
| InChIKey | ZMTCJMNSHDRLQB-XFAGBWLFSA-N |
| XLogP | 0.42 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|