C22H42N6O3 — CID 71585984
2-[3-[(3S)-1-acetyl-6,6-diethyl-5,8-dioxo-1,4,7-triazacyclopentadec-3-yl]propyl]guanidine (PubChem CID 71585984) has the molecular formula C22H42N6O3 and a molecular weight of 438.62 g/mol. Its IUPAC name is 2-[3-[(3S)-1-acetyl-6,6-diethyl-5,8-dioxo-1,4,7-triazacyclopentadec-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3S)-1-acetyl-6,6-diethyl-5,8-dioxo-1,4,7-triazacyclopentadec-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 71585984 |
| Molecular Formula | C22H42N6O3 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 2-[3-[(3S)-1-acetyl-6,6-diethyl-5,8-dioxo-1,4,7-triazacyclopentadec-3-yl]propyl]guanidine |
| SMILES | CCC1(CC)NC(=O)CCCCCCCN(C(C)=O)C[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C22H42N6O3/c1-4-22(5-2)20(31)26-18(12-11-14-25-21(23)24)16-28(17(3)29)15-10-8-6-7-9-13-19(30)27-22/h18H,4-16H2,1-3H3,(H,26,31)(H,27,30)(H4,23,24,25)/t18-/m0/s1 |
| InChIKey | FAPRAYOGKNJDJW-SFHVURJKSA-N |
| XLogP | 1.40 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|