C17H15F2N3O4 — CID 71586153
5-(3,4-difluoro-5-methoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione (PubChem CID 71586153) has the molecular formula C17H15F2N3O4 and a molecular weight of 363.32 g/mol. Its IUPAC name is 5-(3,4-difluoro-5-methoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-difluoro-5-methoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71586153 |
| Molecular Formula | C17H15F2N3O4 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 5-(3,4-difluoro-5-methoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(C2(Cn3cccc(C)c3=O)NC(=O)NC2=O)cc(F)c1F |
| InChI | InChI=1S/C17H15F2N3O4/c1-9-4-3-5-22(14(9)23)8-17(15(24)20-16(25)21-17)10-6-11(18)13(19)12(7-10)26-2/h3-7H,8H2,1-2H3,(H2,20,21,24,25) |
| InChIKey | JHUKKIWPYFLEAQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|