C24H23N5O4S — CID 71586283
N-[4-[4-[5-(2-methoxyethoxy)pyrazin-2-yl]oxy-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 71586283) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[4-[4-[5-(2-methoxyethoxy)pyrazin-2-yl]oxy-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-[5-(2-methoxyethoxy)pyrazin-2-yl]oxy-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71586283 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[4-[4-[5-(2-methoxyethoxy)pyrazin-2-yl]oxy-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | COCCOc1cnc(Oc2cc(C)c(-c3csc(NC(=O)c4ccncc4)n3)c(C)c2)cn1 |
| InChI | InChI=1S/C24H23N5O4S/c1-15-10-18(33-21-13-26-20(12-27-21)32-9-8-31-3)11-16(2)22(15)19-14-34-24(28-19)29-23(30)17-4-6-25-7-5-17/h4-7,10-14H,8-9H2,1-3H3,(H,28,29,30) |
| InChIKey | DHKNWIMBBMORIS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|