C26H23F2N5O2 — CID 71586416
7-[2-[3-(4-fluoro-3-methylphenyl)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]acetyl]-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one (PubChem CID 71586416) has the molecular formula C26H23F2N5O2 and a molecular weight of 475.50 g/mol. Its IUPAC name is 7-[2-[3-(4-fluoro-3-methylphenyl)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]acetyl]-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one.
| Compound Name | 7-[2-[3-(4-fluoro-3-methylphenyl)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]acetyl]-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one |
|---|---|
| PubChem CID | 71586416 |
| Molecular Formula | C26H23F2N5O2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 7-[2-[3-(4-fluoro-3-methylphenyl)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]acetyl]-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one |
| SMILES | Cc1cc(-c2nc(-c3ccc(F)cc3)n(CC(=O)N3CCc4ccc(=O)[nH]c4CC3)n2)ccc1F |
| InChI | InChI=1S/C26H23F2N5O2/c1-16-14-19(4-8-21(16)28)25-30-26(18-2-6-20(27)7-3-18)33(31-25)15-24(35)32-12-10-17-5-9-23(34)29-22(17)11-13-32/h2-9,14H,10-13,15H2,1H3,(H,29,34) |
| InChIKey | PEJSWAMROQKTHS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |