C23H31N5O2 — CID 71586728
(E)-N-[3-[(E)-1-(4,6-dimethylpyrimidin-2-yl)ethylideneamino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 71586728) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (E)-N-[3-[(E)-1-(4,6-dimethylpyrimidin-2-yl)ethylideneamino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-N-[3-[(E)-1-(4,6-dimethylpyrimidin-2-yl)ethylideneamino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 71586728 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | (E)-N-[3-[(E)-1-(4,6-dimethylpyrimidin-2-yl)ethylideneamino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | C/C(=N\OCC(C)(C)CO/N=C1\CCCc2ccc(C)nc21)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C23H31N5O2/c1-15-10-11-19-8-7-9-20(21(19)24-15)28-30-14-23(5,6)13-29-27-18(4)22-25-16(2)12-17(3)26-22/h10-12H,7-9,13-14H2,1-6H3/b27-18+,28-20+ |
| InChIKey | JSSRZPQBPLBJQI-FDFSFIAOSA-N |
| XLogP | 4.32 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|