C20H19N5O2 — CID 71586730
7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline (PubChem CID 71586730) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline.
| Compound Name | 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline |
|---|---|
| PubChem CID | 71586730 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline |
| SMILES | Cc1ncc(C)n2nc(CCc3ccc4cc5c(cc4n3)OCCO5)nc12 |
| InChI | InChI=1S/C20H19N5O2/c1-12-11-21-13(2)20-23-19(24-25(12)20)6-5-15-4-3-14-9-17-18(10-16(14)22-15)27-8-7-26-17/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | MOIMSOJRAIPJMQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |