About (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one
(1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one (PubChem CID 71586811) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one.
Molecular Properties
| Compound Name | (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one |
| PubChem CID | 71586811 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one |
| SMILES | O=C1Oc2ccccc2[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C10H8O2/c11-10-8-5-7(8)6-3-1-2-4-9(6)12-10/h1-4,7-8H,5H2/t7-,8-/m1/s1 |
| InChIKey | BSNSPNHWEMGXBT-HTQZYQBOSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one?
The IUPAC name of (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one (CID 71586811) is (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one.
What is the SMILES notation for (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one?
The canonical SMILES for (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one is O=C1Oc2ccccc2[C@H]2C[C@@H]12.
What is the InChIKey of (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one?
The InChIKey is BSNSPNHWEMGXBT-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H8O2/c11-10-8-5-7(8)6-3-1-2-4-9(6)12-10/h1-4,7-8H,5H2/t7-,8-/m1/s1.
What are the key properties of (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one?
(1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one has a molecular weight of 160.17 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1aR,7bS)-1a,7b-dihydro-1H-cyclopropa[c]chromen-2-one is sourced from PubChem (CID 71586811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).