About benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide
benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide (PubChem CID 71586908) has the molecular formula C27H35N3O4
and a molecular weight of 465.59 g/mol. Its IUPAC name is benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| PubChem CID | 71586908 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| SMILES | CCCCOc1cc(C(=O)NCCN(CC)CC)c2ccccc2n1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C20H29N3O2.C7H6O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;8-7(9)6-4-2-1-3-5-6/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);1-5H,(H,8,9) |
| InChIKey | JULGWEYQFOTHCW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide?
The IUPAC name of benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide (CID 71586908) is benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide.
What is the SMILES notation for benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide?
The canonical SMILES for benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide is CCCCOc1cc(C(=O)NCCN(CC)CC)c2ccccc2n1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide?
The InChIKey is JULGWEYQFOTHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O2.C7H6O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;8-7(9)6-4-2-1-3-5-6/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);1-5H,(H,8,9).
What are the key properties of benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide?
benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide has a molecular weight of 465.59 g/mol, XLogP of 4.87, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide is sourced from PubChem (CID 71586908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).