About trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one
trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one (PubChem CID 71587112) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one |
| PubChem CID | 71587112 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one |
| SMILES | CC(C)[C@@H]1CC[C@](C)(S)CC1=O |
| InChI | InChI=1S/C10H18OS/c1-7(2)8-4-5-10(3,12)6-9(8)11/h7-8,12H,4-6H2,1-3H3/t8-,10-/m0/s1 |
| InChIKey | LCFWUUYRTYROGC-WPRPVWTQSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one?
The IUPAC name of trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one (CID 71587112) is trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one.
What is the SMILES notation for trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one?
The canonical SMILES for trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one is CC(C)[C@@H]1CC[C@](C)(S)CC1=O.
What is the InChIKey of trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one?
The InChIKey is LCFWUUYRTYROGC-WPRPVWTQSA-N. The full InChI is InChI=1S/C10H18OS/c1-7(2)8-4-5-10(3,12)6-9(8)11/h7-8,12H,4-6H2,1-3H3/t8-,10-/m0/s1.
What are the key properties of trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one?
trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one has a molecular weight of 186.32 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,5S)-5-methyl-2-propan-2-yl-5-sulfanylcyclohexan-1-one is sourced from PubChem (CID 71587112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).