About furan-2-ylmethyl decanoate
furan-2-ylmethyl decanoate (PubChem CID 71587144) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is furan-2-ylmethyl decanoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl decanoate |
| PubChem CID | 71587144 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | furan-2-ylmethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCc1ccco1 |
| InChI | InChI=1S/C15H24O3/c1-2-3-4-5-6-7-8-11-15(16)18-13-14-10-9-12-17-14/h9-10,12H,2-8,11,13H2,1H3 |
| InChIKey | ATRAUOWSKCEACM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze furan-2-ylmethyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl decanoate?
The IUPAC name of furan-2-ylmethyl decanoate (CID 71587144) is furan-2-ylmethyl decanoate.
What is the SMILES notation for furan-2-ylmethyl decanoate?
The canonical SMILES for furan-2-ylmethyl decanoate is CCCCCCCCCC(=O)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl decanoate?
The InChIKey is ATRAUOWSKCEACM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-2-3-4-5-6-7-8-11-15(16)18-13-14-10-9-12-17-14/h9-10,12H,2-8,11,13H2,1H3.
What are the key properties of furan-2-ylmethyl decanoate?
furan-2-ylmethyl decanoate has a molecular weight of 252.35 g/mol, XLogP of 4.46, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl decanoate is sourced from PubChem (CID 71587144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).