C25H42O6 — CID 71587180
2,3-diacetyloxypropyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 71587180) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2,3-diacetyloxypropyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2,3-diacetyloxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 71587180 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2,3-diacetyloxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H42O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)30-21-24(31-23(3)27)20-29-22(2)26/h8-9,11-12,24H,4-7,10,13-21H2,1-3H3/b9-8-,12-11- |
| InChIKey | BVIPVQLDRBBSFA-MURFETPASA-N |
| XLogP | 5.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|