C27H56N2O6S — CID 71587423
ethyl-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl]-dimethylazanium;ethyl sulfate (PubChem CID 71587423) has the molecular formula C27H56N2O6S and a molecular weight of 536.82 g/mol. Its IUPAC name is ethyl-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl]-dimethylazanium;ethyl sulfate.
| Compound Name | ethyl-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl]-dimethylazanium;ethyl sulfate |
|---|---|
| PubChem CID | 71587423 |
| Molecular Formula | C27H56N2O6S |
| Molecular Weight | 536.82 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | ethyl-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl]-dimethylazanium;ethyl sulfate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)CC.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C25H50N2O2.C2H6O4S/c1-5-7-8-15-19-24(28)20-16-13-11-9-10-12-14-17-21-25(29)26-22-18-23-27(3,4)6-2;1-2-6-7(3,4)5/h13,16,24,28H,5-12,14-15,17-23H2,1-4H3;2H2,1H3,(H,3,4,5)/b16-13-;/t24-;/m1./s1 |
| InChIKey | VDNMPXDJBJILBP-UNUNFZTGSA-N |
| XLogP | 5.08 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|