C8H15NS2 — CID 71587434
(2S,4S,8aR)-2,4-dimethyl-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-d][1,3,5]dithiazine (PubChem CID 71587434) has the molecular formula C8H15NS2 and a molecular weight of 189.35 g/mol. Its IUPAC name is (2S,4S,8aR)-2,4-dimethyl-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-d][1,3,5]dithiazine.
| Compound Name | (2S,4S,8aR)-2,4-dimethyl-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-d][1,3,5]dithiazine |
|---|---|
| PubChem CID | 71587434 |
| Molecular Formula | C8H15NS2 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2S,4S,8aR)-2,4-dimethyl-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-d][1,3,5]dithiazine |
| SMILES | C[C@H]1S[C@@H](C)N2CCC[C@H]2S1 |
| InChI | InChI=1S/C8H15NS2/c1-6-9-5-3-4-8(9)11-7(2)10-6/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | OJEOXDLLIADRBL-BIIVOSGPSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |