C82H152N4O6 — CID 71587460
10-[2-(7-carboxyheptyl)-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enoic acid;bis((9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide) (PubChem CID 71587460) has the molecular formula C82H152N4O6 and a molecular weight of 1290.14 g/mol. Its IUPAC name is 10-[2-(7-carboxyheptyl)-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enoic acid;bis((9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide).
| Compound Name | 10-[2-(7-carboxyheptyl)-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enoic acid;bis((9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide) |
|---|---|
| PubChem CID | 71587460 |
| Molecular Formula | C82H152N4O6 |
| Molecular Weight | 1290.14 g/mol |
| Exact Mass | 1289.17 |
| IUPAC Name | 10-[2-(7-carboxyheptyl)-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enoic acid;bis((9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCCN(C)C.CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCCN(C)C.CCCCCCC1C=CC(CCCCCCCC(=O)O)C(C=CCCCCCCCC(=O)O)C1CCCCCC |
| InChI | InChI=1S/C36H64O4.2C23H44N2O/c1-3-5-7-17-23-31-29-30-32(24-18-13-12-16-22-28-36(39)40)34(33(31)25-19-8-6-4-2)26-20-14-10-9-11-15-21-27-35(37)38;2*1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h20,26,29-34H,3-19,21-25,27-28H2,1-2H3,(H,37,38)(H,39,40);2*8-9,11-12H,4-7,10,13-22H2,1-3H3,(H,24,26)/b;2*9-8-,12-11- |
| InChIKey | MQNQIUBNXWEKEM-UWGQPTJQSA-N |
| XLogP | 22.88 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 63 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1290.14 |
| LogP ≤ 5 | 22.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|