About S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate
S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate (PubChem CID 71587516) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate |
| PubChem CID | 71587516 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate |
| SMILES | CC(=O)SC(C)(C)[C@H]1CC[C@H](C)CC1=O |
| InChI | InChI=1S/C12H20O2S/c1-8-5-6-10(11(14)7-8)12(3,4)15-9(2)13/h8,10H,5-7H2,1-4H3/t8-,10-/m0/s1 |
| InChIKey | AMXPURQVAMENCC-WPRPVWTQSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate?
The IUPAC name of S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate (CID 71587516) is S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate.
What is the SMILES notation for S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate?
The canonical SMILES for S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate is CC(=O)SC(C)(C)[C@H]1CC[C@H](C)CC1=O.
What is the InChIKey of S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate?
The InChIKey is AMXPURQVAMENCC-WPRPVWTQSA-N. The full InChI is InChI=1S/C12H20O2S/c1-8-5-6-10(11(14)7-8)12(3,4)15-9(2)13/h8,10H,5-7H2,1-4H3/t8-,10-/m0/s1.
What are the key properties of S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate?
S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate has a molecular weight of 228.36 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[(1S,4S)-4-methyl-2-oxocyclohexyl]propan-2-yl] ethanethioate is sourced from PubChem (CID 71587516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).