About disodium;(2S)-2-(octanoylamino)pentanedioate
disodium;(2S)-2-(octanoylamino)pentanedioate (PubChem CID 71587566) has the molecular formula C13H21NNa2O5
and a molecular weight of 317.29 g/mol. Its IUPAC name is disodium;(2S)-2-(octanoylamino)pentanedioate.
Molecular Properties
| Compound Name | disodium;(2S)-2-(octanoylamino)pentanedioate |
| PubChem CID | 71587566 |
| Molecular Formula | C13H21NNa2O5 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | disodium;(2S)-2-(octanoylamino)pentanedioate |
| SMILES | CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H23NO5.2Na/c1-2-3-4-5-6-7-11(15)14-10(13(18)19)8-9-12(16)17;;/h10H,2-9H2,1H3,(H,14,15)(H,16,17)(H,18,19);;/q;2*+1/p-2/t10-;;/m0../s1 |
| InChIKey | JRHWWJSWHFFZRY-XRIOVQLTSA-L |
| XLogP | -6.88 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;(2S)-2-(octanoylamino)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-2-(octanoylamino)pentanedioate?
The IUPAC name of disodium;(2S)-2-(octanoylamino)pentanedioate (CID 71587566) is disodium;(2S)-2-(octanoylamino)pentanedioate.
What is the SMILES notation for disodium;(2S)-2-(octanoylamino)pentanedioate?
The canonical SMILES for disodium;(2S)-2-(octanoylamino)pentanedioate is CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-2-(octanoylamino)pentanedioate?
The InChIKey is JRHWWJSWHFFZRY-XRIOVQLTSA-L. The full InChI is InChI=1S/C13H23NO5.2Na/c1-2-3-4-5-6-7-11(15)14-10(13(18)19)8-9-12(16)17;;/h10H,2-9H2,1H3,(H,14,15)(H,16,17)(H,18,19);;/q;2*+1/p-2/t10-;;/m0../s1.
What are the key properties of disodium;(2S)-2-(octanoylamino)pentanedioate?
disodium;(2S)-2-(octanoylamino)pentanedioate has a molecular weight of 317.29 g/mol, XLogP of -6.88, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-2-(octanoylamino)pentanedioate is sourced from PubChem (CID 71587566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).