About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate (PubChem CID 71587572) has the molecular formula C16H30O5
and a molecular weight of 302.41 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate |
| PubChem CID | 71587572 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate |
| SMILES | CCCCCC(O)CCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H30O5/c1-4-5-6-8-13(17)9-7-10-15(18)19-11-14-12-20-16(2,3)21-14/h13-14,17H,4-12H2,1-3H3 |
| InChIKey | REYDYLGZGYQXQP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate (CID 71587572) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate is CCCCCC(O)CCCC(=O)OCC1COC(C)(C)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate?
The InChIKey is REYDYLGZGYQXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O5/c1-4-5-6-8-13(17)9-7-10-15(18)19-11-14-12-20-16(2,3)21-14/h13-14,17H,4-12H2,1-3H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate has a molecular weight of 302.41 g/mol, XLogP of 2.79, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-hydroxydecanoate is sourced from PubChem (CID 71587572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).