About 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide
2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide (PubChem CID 71587580) has the molecular formula C14H9I4NO3
and a molecular weight of 746.85 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide |
| PubChem CID | 71587580 |
| Molecular Formula | C14H9I4NO3 |
| Molecular Weight | 746.85 g/mol |
| Exact Mass | 746.68 |
| IUPAC Name | 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide |
| SMILES | NC(=O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C14H9I4NO3/c15-8-4-7(5-9(16)13(8)21)22-14-10(17)1-6(2-11(14)18)3-12(19)20/h1-2,4-5,21H,3H2,(H2,19,20) |
| InChIKey | MNMHUDWTDPTECO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 746.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide?
The IUPAC name of 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide (CID 71587580) is 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide.
What is the SMILES notation for 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide?
The canonical SMILES for 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide is NC(=O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1.
What is the InChIKey of 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide?
The InChIKey is MNMHUDWTDPTECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9I4NO3/c15-8-4-7(5-9(16)13(8)21)22-14-10(17)1-6(2-11(14)18)3-12(19)20/h1-2,4-5,21H,3H2,(H2,19,20).
What are the key properties of 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide?
2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide has a molecular weight of 746.85 g/mol, XLogP of 4.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetamide is sourced from PubChem (CID 71587580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).