C44H86N2O4 — CID 71587600
2-hexyldecyl N-[3-[(2-hexyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 71587600) has the molecular formula C44H86N2O4 and a molecular weight of 707.18 g/mol. Its IUPAC name is 2-hexyldecyl N-[3-[(2-hexyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2-hexyldecyl N-[3-[(2-hexyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 71587600 |
| Molecular Formula | C44H86N2O4 |
| Molecular Weight | 707.18 g/mol |
| Exact Mass | 706.66 |
| IUPAC Name | 2-hexyldecyl N-[3-[(2-hexyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)NCC1(C)CC(NC(=O)OCC(CCCCCC)CCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C44H86N2O4/c1-8-12-16-20-22-26-30-38(28-24-18-14-10-3)34-49-41(47)45-37-44(7)33-40(32-43(5,6)36-44)46-42(48)50-35-39(29-25-19-15-11-4)31-27-23-21-17-13-9-2/h38-40H,8-37H2,1-7H3,(H,45,47)(H,46,48) |
| InChIKey | XXRXLPISWRNWDZ-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.18 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|