C48H94N2O4 — CID 71587601
2-octyldecyl N-[[1,3,3-trimethyl-5-(2-octyldecoxycarbonylamino)cyclohexyl]methyl]carbamate (PubChem CID 71587601) has the molecular formula C48H94N2O4 and a molecular weight of 763.29 g/mol. Its IUPAC name is 2-octyldecyl N-[[1,3,3-trimethyl-5-(2-octyldecoxycarbonylamino)cyclohexyl]methyl]carbamate.
| Compound Name | 2-octyldecyl N-[[1,3,3-trimethyl-5-(2-octyldecoxycarbonylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 71587601 |
| Molecular Formula | C48H94N2O4 |
| Molecular Weight | 763.29 g/mol |
| Exact Mass | 762.72 |
| IUPAC Name | 2-octyldecyl N-[[1,3,3-trimethyl-5-(2-octyldecoxycarbonylamino)cyclohexyl]methyl]carbamate |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)NCC1(C)CC(NC(=O)OCC(CCCCCCCC)CCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C48H94N2O4/c1-8-12-16-20-24-28-32-42(33-29-25-21-17-13-9-2)38-53-45(51)49-41-48(7)37-44(36-47(5,6)40-48)50-46(52)54-39-43(34-30-26-22-18-14-10-3)35-31-27-23-19-15-11-4/h42-44H,8-41H2,1-7H3,(H,49,51)(H,50,52) |
| InChIKey | UNPITQLQSYOPNI-UHFFFAOYSA-N |
| XLogP | 15.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.29 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|