C13H22O3 — CID 71587781
[2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 71587781) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 71587781 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CC(C)=CCC/C(C)=C\C1OCC(CO)O1 |
| InChI | InChI=1S/C13H22O3/c1-10(2)5-4-6-11(3)7-13-15-9-12(8-14)16-13/h5,7,12-14H,4,6,8-9H2,1-3H3/b11-7- |
| InChIKey | PARQKBHRABMRKU-XFFZJAGNSA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|