C16H26O2 — CID 71587886
[(E,2S)-3-methyl-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-yl] acetate (PubChem CID 71587886) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is [(E,2S)-3-methyl-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-yl] acetate.
| Compound Name | [(E,2S)-3-methyl-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 71587886 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [(E,2S)-3-methyl-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]but-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)/C(C)=C/[C@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C16H26O2/c1-11-8-7-9-16(5,6)15(11)10-12(2)13(3)18-14(4)17/h8,10,13,15H,7,9H2,1-6H3/b12-10+/t13-,15-/m0/s1 |
| InChIKey | TYUPZTIJMKMYHL-PYHCZJRBSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|