C24H20N4O4 — CID 71588270
methyl 4-[[3-[(3-carbamoylindazol-1-yl)methyl]phenyl]carbamoyl]benzoate (PubChem CID 71588270) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is methyl 4-[[3-[(3-carbamoylindazol-1-yl)methyl]phenyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-[(3-carbamoylindazol-1-yl)methyl]phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 71588270 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 4-[[3-[(3-carbamoylindazol-1-yl)methyl]phenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cccc(Cn3nc(C(N)=O)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c1-32-24(31)17-11-9-16(10-12-17)23(30)26-18-6-4-5-15(13-18)14-28-20-8-3-2-7-19(20)21(27-28)22(25)29/h2-13H,14H2,1H3,(H2,25,29)(H,26,30) |
| InChIKey | BRFYJRFDMKHBCL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |