C19H16N4O2 — CID 71588283
13-piperidin-1-yl-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione (PubChem CID 71588283) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 13-piperidin-1-yl-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione.
| Compound Name | 13-piperidin-1-yl-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
|---|---|
| PubChem CID | 71588283 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 13-piperidin-1-yl-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
| SMILES | O=C1c2ccc(N3CCCCC3)cc2-n2c1nc1ncccc1c2=O |
| InChI | InChI=1S/C19H16N4O2/c24-16-13-7-6-12(22-9-2-1-3-10-22)11-15(13)23-18(16)21-17-14(19(23)25)5-4-8-20-17/h4-8,11H,1-3,9-10H2 |
| InChIKey | PBQYJODZQQZOBD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |