C20H24O4 — CID 71588362
5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one (PubChem CID 71588362) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one.
| Compound Name | 5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 71588362 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one |
| SMILES | C=CC(C)(C)C1C2=C(C=CC(C)(C)O2)C(OC)=C2C=CC(=O)OC21 |
| InChI | InChI=1S/C20H24O4/c1-7-19(2,3)15-17-12(8-9-14(21)23-17)16(22-6)13-10-11-20(4,5)24-18(13)15/h7-11,15,17H,1H2,2-6H3 |
| InChIKey | UQNRUUXBHDRMLJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|