C34H44N4O7 — CID 71588514
(4-nitrophenyl)methyl N-[1-[[(3S,4R)-1-(cyclopentanecarbonyl)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 71588514) has the molecular formula C34H44N4O7 and a molecular weight of 620.75 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[(3S,4R)-1-(cyclopentanecarbonyl)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[(3S,4R)-1-(cyclopentanecarbonyl)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 71588514 |
| Molecular Formula | C34H44N4O7 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[(3S,4R)-1-(cyclopentanecarbonyl)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@H]2CN(C(=O)C3CCCC3)C[C@]2(O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C34H44N4O7/c1-3-18-37(33(40)45-23-25-8-12-30(13-9-25)38(42)43)29-16-19-35(20-17-29)21-28-22-36(32(39)26-6-4-5-7-26)24-34(28,41)27-10-14-31(44-2)15-11-27/h3,8-15,26,28-29,41H,1,4-7,16-24H2,2H3/t28-,34-/m0/s1 |
| InChIKey | WRNRBNRYAMGPHA-GVYVVWIYSA-N |
| XLogP | 4.73 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|