C21H28F3N5O3 — CID 71588873
tert-butyl 4-[[4-(pentylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 71588873) has the molecular formula C21H28F3N5O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is tert-butyl 4-[[4-(pentylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-(pentylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 71588873 |
| Molecular Formula | C21H28F3N5O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | tert-butyl 4-[[4-(pentylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCCCCNc1nc(Nc2ccc(C(=O)OC(C)(C)C)cc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C21H28F3N5O3/c1-5-6-7-12-25-17-27-18(29-19(28-17)31-13-21(22,23)24)26-15-10-8-14(9-11-15)16(30)32-20(2,3)4/h8-11H,5-7,12-13H2,1-4H3,(H2,25,26,27,28,29) |
| InChIKey | PRGOEXVBESQRDM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|