C9H17NO4 — CID 71589114
2-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1,1-dimethylpyrrolidin-1-ium-2-yl]acetate (PubChem CID 71589114) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1,1-dimethylpyrrolidin-1-ium-2-yl]acetate.
| Compound Name | 2-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1,1-dimethylpyrrolidin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 71589114 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1,1-dimethylpyrrolidin-1-ium-2-yl]acetate |
| SMILES | C[N+]1(C)[C@H](CC(=O)[O-])C[C@@H](O)[C@@H]1CO |
| InChI | InChI=1S/C9H17NO4/c1-10(2)6(4-9(13)14)3-8(12)7(10)5-11/h6-8,11-12H,3-5H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | SEGYZMIPICVQRA-BIIVOSGPSA-N |
| XLogP | -2.30 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|