C26H25FN4O5 — CID 71589529
benzyl (1R,9S)-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7,11-triazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate (PubChem CID 71589529) has the molecular formula C26H25FN4O5 and a molecular weight of 492.51 g/mol. Its IUPAC name is benzyl (1R,9S)-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7,11-triazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate.
| Compound Name | benzyl (1R,9S)-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7,11-triazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 71589529 |
| Molecular Formula | C26H25FN4O5 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | benzyl (1R,9S)-4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7,11-triazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc2n(c(=O)c1O)C[C@@H]1C[C@@H]2CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C26H25FN4O5/c27-20-8-6-16(7-9-20)11-28-24(33)21-22(32)25(34)31-13-18-10-19(23(31)29-21)14-30(12-18)26(35)36-15-17-4-2-1-3-5-17/h1-9,18-19,32H,10-15H2,(H,28,33)/t18-,19-/m1/s1 |
| InChIKey | SYNPGDILDJCZFV-RTBURBONSA-N |
| XLogP | 2.77 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |