About [1,3]dithiolo[4,5-b]quinoxaline-2-thione
[1,3]dithiolo[4,5-b]quinoxaline-2-thione (PubChem CID 7159) has the molecular formula C9H4N2S3
and a molecular weight of 236.35 g/mol. Its IUPAC name is [1,3]dithiolo[4,5-b]quinoxaline-2-thione.
Molecular Properties
| Compound Name | [1,3]dithiolo[4,5-b]quinoxaline-2-thione |
| PubChem CID | 7159 |
| Molecular Formula | C9H4N2S3 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | [1,3]dithiolo[4,5-b]quinoxaline-2-thione |
| SMILES | S=c1sc2nc3ccccc3nc2s1 |
| InChI | InChI=1S/C9H4N2S3/c12-9-13-7-8(14-9)11-6-4-2-1-3-5(6)10-7/h1-4H |
| InChIKey | ILERPRJWJPJZDN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1,3]dithiolo[4,5-b]quinoxaline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dithiolo[4,5-b]quinoxaline-2-thione?
The IUPAC name of [1,3]dithiolo[4,5-b]quinoxaline-2-thione (CID 7159) is [1,3]dithiolo[4,5-b]quinoxaline-2-thione.
What is the SMILES notation for [1,3]dithiolo[4,5-b]quinoxaline-2-thione?
The canonical SMILES for [1,3]dithiolo[4,5-b]quinoxaline-2-thione is S=c1sc2nc3ccccc3nc2s1.
What is the InChIKey of [1,3]dithiolo[4,5-b]quinoxaline-2-thione?
The InChIKey is ILERPRJWJPJZDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2S3/c12-9-13-7-8(14-9)11-6-4-2-1-3-5(6)10-7/h1-4H.
What are the key properties of [1,3]dithiolo[4,5-b]quinoxaline-2-thione?
[1,3]dithiolo[4,5-b]quinoxaline-2-thione has a molecular weight of 236.35 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dithiolo[4,5-b]quinoxaline-2-thione is sourced from PubChem (CID 7159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).