C19H23ClN4O3 — CID 71590349
1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea (PubChem CID 71590349) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 71590349 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
| SMILES | COc1cc(OC)c(NC(=O)NCCc2ccc3c(n2)NCCC3)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O3/c1-26-16-11-17(27-2)15(10-14(16)20)24-19(25)22-9-7-13-6-5-12-4-3-8-21-18(12)23-13/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,21,23)(H2,22,24,25) |
| InChIKey | APNHDUNMDZMPSC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |