C19H24N4O3 — CID 71590395
1-(3,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea (PubChem CID 71590395) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 71590395 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCc2ccc3c(n2)NCCC3)cc1OC |
| InChI | InChI=1S/C19H24N4O3/c1-25-16-8-7-15(12-17(16)26-2)23-19(24)21-11-9-14-6-5-13-4-3-10-20-18(13)22-14/h5-8,12H,3-4,9-11H2,1-2H3,(H,20,22)(H2,21,23,24) |
| InChIKey | OIIIWSLMRDPLGW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |