C26H40O6 — CID 71590576
[(3aR,5aS,6R,7R,9aR,9bS)-6-(hydroxymethyl)-3a,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] hexanoate (PubChem CID 71590576) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(3aR,5aS,6R,7R,9aR,9bS)-6-(hydroxymethyl)-3a,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] hexanoate.
| Compound Name | [(3aR,5aS,6R,7R,9aR,9bS)-6-(hydroxymethyl)-3a,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] hexanoate |
|---|---|
| PubChem CID | 71590576 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [(3aR,5aS,6R,7R,9aR,9bS)-6-(hydroxymethyl)-3a,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1CC[C@]2(C)[C@H](CC[C@@]3(C)OC(C4=CCOC4=O)C[C@@H]23)[C@]1(C)CO |
| InChI | InChI=1S/C26H40O6/c1-5-6-7-8-22(28)31-21-10-12-24(2)19(25(21,3)16-27)9-13-26(4)20(24)15-18(32-26)17-11-14-30-23(17)29/h11,18-21,27H,5-10,12-16H2,1-4H3/t18?,19-,20-,21+,24+,25-,26+/m0/s1 |
| InChIKey | YZMGEFFHFZJEGF-LKBQLODYSA-N |
| XLogP | 4.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|