About 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione
4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione (PubChem CID 71590596) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione.
Molecular Properties
| Compound Name | 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione |
| PubChem CID | 71590596 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione |
| SMILES | CCCCCC[C@H](C)CC1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C19H24O3/c1-3-4-5-6-9-13(2)12-16-17(20)14-10-7-8-11-15(14)18(21)19(16)22/h7-8,10-11,13,20H,3-6,9,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | OCFLQPHYDHBHOU-ZDUSSCGKSA-N |
| XLogP | 4.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione?
The IUPAC name of 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione (CID 71590596) is 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione.
What is the SMILES notation for 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione?
The canonical SMILES for 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione is CCCCCC[C@H](C)CC1=C(O)c2ccccc2C(=O)C1=O.
What is the InChIKey of 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione?
The InChIKey is OCFLQPHYDHBHOU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H24O3/c1-3-4-5-6-9-13(2)12-16-17(20)14-10-7-8-11-15(14)18(21)19(16)22/h7-8,10-11,13,20H,3-6,9,12H2,1-2H3/t13-/m0/s1.
What are the key properties of 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione?
4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione has a molecular weight of 300.40 g/mol, XLogP of 4.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-[(2S)-2-methyloctyl]naphthalene-1,2-dione is sourced from PubChem (CID 71590596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).