C17H24ClN3O3 — CID 71590634
N'-(4-chloro-3-hydroxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 71590634) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is N'-(4-chloro-3-hydroxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(4-chloro-3-hydroxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 71590634 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N'-(4-chloro-3-hydroxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Nc2ccc(Cl)c(O)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-16(2)8-11(9-17(3,4)21-16)20-15(24)14(23)19-10-5-6-12(18)13(22)7-10/h5-7,11,21-22H,8-9H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | IVNXWHJARCCZLS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|