C22H24O9 — CID 71590683
(Z)-3-hydroxy-1-[2-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(3-methylphenyl)prop-2-en-1-one (PubChem CID 71590683) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is (Z)-3-hydroxy-1-[2-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-1-[2-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71590683 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (Z)-3-hydroxy-1-[2-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(/C(O)=C/C(=O)c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2O)c1 |
| InChI | InChI=1S/C22H24O9/c1-11-3-2-4-12(7-11)15(24)9-17(26)14-6-5-13(8-16(14)25)30-22-21(29)20(28)19(27)18(10-23)31-22/h2-9,18-25,27-29H,10H2,1H3/b15-9-/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | LUQBYKQBALAVHZ-POHJANSLSA-N |
| XLogP | 0.66 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|