C23H15F4NO3 — CID 71592085
3-(2-fluorophenyl)-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 71592085) has the molecular formula C23H15F4NO3 and a molecular weight of 429.37 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-(2-fluorophenyl)-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 71592085 |
| Molecular Formula | C23H15F4NO3 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2F)c2ccccc2n1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F4NO3/c24-18-10-3-1-8-16(18)20-17-9-2-4-11-19(17)28(21(20)22(29)30)13-14-6-5-7-15(12-14)31-23(25,26)27/h1-12H,13H2,(H,29,30) |
| InChIKey | PGMXHXBUQDKCID-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |