C20H22N2O3 — CID 71592309
4-(6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c][1,2]oxazol-3-yl)-N,N-dimethylaniline (PubChem CID 71592309) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c][1,2]oxazol-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c][1,2]oxazol-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71592309 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-(6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c][1,2]oxazol-3-yl)-N,N-dimethylaniline |
| SMILES | COc1cc2c(cc1OC)C1=NOC(c3ccc(N(C)C)cc3)C1C2 |
| InChI | InChI=1S/C20H22N2O3/c1-22(2)14-7-5-12(6-8-14)20-16-9-13-10-17(23-3)18(24-4)11-15(13)19(16)21-25-20/h5-8,10-11,16,20H,9H2,1-4H3 |
| InChIKey | BXDWTLSTWLGIPV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|