C30H21FN2O2 — CID 71592578
3-[[6-[1-(4-fluorophenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 71592578) has the molecular formula C30H21FN2O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is 3-[[6-[1-(4-fluorophenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[1-(4-fluorophenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 71592578 |
| Molecular Formula | C30H21FN2O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-[[6-[1-(4-fluorophenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2ccc3ccc(-c4ccc5ccn(-c6ccc(F)cc6)c5c4)cc32)c1 |
| InChI | InChI=1S/C30H21FN2O2/c31-26-8-10-27(11-9-26)33-15-13-22-5-7-24(18-29(22)33)23-6-4-21-12-14-32(28(21)17-23)19-20-2-1-3-25(16-20)30(34)35/h1-18H,19H2,(H,34,35) |
| InChIKey | KSTOQQHZQACXLT-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |