C31H24N4Se2 — CID 71592801
(4S)-4-[(R)-[4-(2-naphthalen-2-ylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole (PubChem CID 71592801) has the molecular formula C31H24N4Se2 and a molecular weight of 610.48 g/mol. Its IUPAC name is (4S)-4-[(R)-[4-(2-naphthalen-2-ylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole.
| Compound Name | (4S)-4-[(R)-[4-(2-naphthalen-2-ylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
|---|---|
| PubChem CID | 71592801 |
| Molecular Formula | C31H24N4Se2 |
| Molecular Weight | 610.48 g/mol |
| Exact Mass | 612.03 |
| IUPAC Name | (4S)-4-[(R)-[4-(2-naphthalen-2-ylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
| SMILES | c1ccc([C@H](c2[se]nnc2-c2ccccc2-c2ccc3ccccc3c2)[C@@H]2CCCc3[se]nnc32)cc1 |
| InChI | InChI=1S/C31H24N4Se2/c1-2-10-21(11-3-1)28(26-15-8-16-27-29(26)32-34-36-27)31-30(33-35-37-31)25-14-7-6-13-24(25)23-18-17-20-9-4-5-12-22(20)19-23/h1-7,9-14,17-19,26,28H,8,15-16H2/t26-,28-/m0/s1 |
| InChIKey | JAFTVBBBOQOJTO-XCZPVHLTSA-N |
| XLogP | 6.12 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|