C31H26N2OSe — CID 71592845
(3R)-1-(2-naphthalen-2-ylphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one (PubChem CID 71592845) has the molecular formula C31H26N2OSe and a molecular weight of 521.52 g/mol. Its IUPAC name is (3R)-1-(2-naphthalen-2-ylphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one.
| Compound Name | (3R)-1-(2-naphthalen-2-ylphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 71592845 |
| Molecular Formula | C31H26N2OSe |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | (3R)-1-(2-naphthalen-2-ylphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
| SMILES | O=C(C[C@@H](c1ccccc1)[C@@H]1CCCc2[se]nnc21)c1ccccc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H26N2OSe/c34-29(26-14-7-6-13-25(26)24-18-17-21-9-4-5-12-23(21)19-24)20-28(22-10-2-1-3-11-22)27-15-8-16-30-31(27)32-33-35-30/h1-7,9-14,17-19,27-28H,8,15-16,20H2/t27-,28-/m0/s1 |
| InChIKey | HWBFEPSEZUOXHO-NSOVKSMOSA-N |
| XLogP | 6.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|