C24H19N7O4Zn — CID 71593207
zinc 2-[(E)-C-methyl-N-[[5-(4-nitrophenyl)-4-[(E)-1-(2-oxidophenyl)ethylideneamino]-1,2,4-triazol-3-yl]amino]carbonimidoyl]phenolate (PubChem CID 71593207) has the molecular formula C24H19N7O4Zn and a molecular weight of 534.85 g/mol. Its IUPAC name is zinc 2-[(E)-C-methyl-N-[[5-(4-nitrophenyl)-4-[(E)-1-(2-oxidophenyl)ethylideneamino]-1,2,4-triazol-3-yl]amino]carbonimidoyl]phenolate.
| Compound Name | zinc 2-[(E)-C-methyl-N-[[5-(4-nitrophenyl)-4-[(E)-1-(2-oxidophenyl)ethylideneamino]-1,2,4-triazol-3-yl]amino]carbonimidoyl]phenolate |
|---|---|
| PubChem CID | 71593207 |
| Molecular Formula | C24H19N7O4Zn |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | zinc 2-[(E)-C-methyl-N-[[5-(4-nitrophenyl)-4-[(E)-1-(2-oxidophenyl)ethylideneamino]-1,2,4-triazol-3-yl]amino]carbonimidoyl]phenolate |
| SMILES | C/C(=N\Nc1nnc(-c2ccc([N+](=O)[O-])cc2)n1/N=C(\C)c1ccccc1[O-])c1ccccc1[O-].[Zn+2] |
| InChI | InChI=1S/C24H21N7O4.Zn/c1-15(19-7-3-5-9-21(19)32)25-27-24-28-26-23(17-11-13-18(14-12-17)31(34)35)30(24)29-16(2)20-8-4-6-10-22(20)33;/h3-14,32-33H,1-2H3,(H,27,28);/q;+2/p-2/b25-15+,29-16+; |
| InChIKey | MIFWRBKFRSVBBF-PHFGFEFUSA-L |
| XLogP | 3.11 |
| TPSA | 156.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|