C19H10BrClN4 — CID 71593608
4-bromo-2-chloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene (PubChem CID 71593608) has the molecular formula C19H10BrClN4 and a molecular weight of 409.67 g/mol. Its IUPAC name is 4-bromo-2-chloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene.
| Compound Name | 4-bromo-2-chloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 71593608 |
| Molecular Formula | C19H10BrClN4 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 4-bromo-2-chloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
| SMILES | Clc1c2cnc3c(cnn3-c3ccccc3)c2nc2cccc(Br)c12 |
| InChI | InChI=1S/C19H10BrClN4/c20-14-7-4-8-15-16(14)17(21)12-9-22-19-13(18(12)24-15)10-23-25(19)11-5-2-1-3-6-11/h1-10H |
| InChIKey | ZJMZDAUUNLRPDD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|