About [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea
[[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea (PubChem CID 7159362) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea.
Molecular Properties
| Compound Name | [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea |
| PubChem CID | 7159362 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea |
| SMILES | CC1=C(C=NNC(N)=O)[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C13H15N3O/c1-8-10-5-3-4-6-11(10)9(2)12(8)7-15-16-13(14)17/h3-8H,1-2H3,(H3,14,16,17)/t8-/m1/s1 |
| InChIKey | PRCIILUEVISNEC-MRVPVSSYSA-N |
| XLogP | 2.23 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea?
The IUPAC name of [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea (CID 7159362) is [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea.
What is the SMILES notation for [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea?
The canonical SMILES for [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea is CC1=C(C=NNC(N)=O)[C@H](C)c2ccccc21.
What is the InChIKey of [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea?
The InChIKey is PRCIILUEVISNEC-MRVPVSSYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-8-10-5-3-4-6-11(10)9(2)12(8)7-15-16-13(14)17/h3-8H,1-2H3,(H3,14,16,17)/t8-/m1/s1.
What are the key properties of [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea?
[[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea has a molecular weight of 229.28 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1R)-1,3-dimethyl-1H-inden-2-yl]methylideneamino]urea is sourced from PubChem (CID 7159362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).