C19H10Cl2N4 — CID 71593658
2,5-dichloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene (PubChem CID 71593658) has the molecular formula C19H10Cl2N4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2,5-dichloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene.
| Compound Name | 2,5-dichloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 71593658 |
| Molecular Formula | C19H10Cl2N4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2,5-dichloro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
| SMILES | Clc1ccc2nc3c(cnc4c3cnn4-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C19H10Cl2N4/c20-11-6-7-16-13(8-11)17(21)14-9-22-19-15(18(14)24-16)10-23-25(19)12-4-2-1-3-5-12/h1-10H |
| InChIKey | XVXVODPTWYKTOB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|