C29H46O7 — CID 71593683
[4-hydroxy-1-[16-hydroxy-13-(hydroxymethyl)-3-oxospiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-yl]-2,3,4-trimethylpentyl] acetate (PubChem CID 71593683) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is [4-hydroxy-1-[16-hydroxy-13-(hydroxymethyl)-3-oxospiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-yl]-2,3,4-trimethylpentyl] acetate.
| Compound Name | [4-hydroxy-1-[16-hydroxy-13-(hydroxymethyl)-3-oxospiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-yl]-2,3,4-trimethylpentyl] acetate |
|---|---|
| PubChem CID | 71593683 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [4-hydroxy-1-[16-hydroxy-13-(hydroxymethyl)-3-oxospiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-yl]-2,3,4-trimethylpentyl] acetate |
| SMILES | CC(=O)OC(C(C)C(C)C(C)(C)O)C1OC12C(O)CC1C3CCC4CC(=O)CCC4C3CCC12CO |
| InChI | InChI=1S/C29H46O7/c1-15(16(2)27(4,5)34)25(35-17(3)31)26-29(36-26)24(33)13-23-22-8-6-18-12-19(32)7-9-20(18)21(22)10-11-28(23,29)14-30/h15-16,18,20-26,30,33-34H,6-14H2,1-5H3 |
| InChIKey | SICQAFSTIAEMDU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|