C28H33NO2 — CID 71594032
(1S,4S,6S)-9-(2-methoxyphenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole (PubChem CID 71594032) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (1S,4S,6S)-9-(2-methoxyphenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole.
| Compound Name | (1S,4S,6S)-9-(2-methoxyphenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 71594032 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (1S,4S,6S)-9-(2-methoxyphenyl)-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
| SMILES | COc1ccccc1-c1nc2c(C)c3c4c(c2o1)[C@@H](C)CCC4[C@@H](C)C[C@H]3C=C(C)C |
| InChI | InChI=1S/C28H33NO2/c1-15(2)13-19-14-17(4)20-12-11-16(3)23-25(20)24(19)18(5)26-27(23)31-28(29-26)21-9-7-8-10-22(21)30-6/h7-10,13,16-17,19-20H,11-12,14H2,1-6H3/t16-,17-,19+,20?/m0/s1 |
| InChIKey | IAMAJRYSKVVGGN-POIHQQSKSA-N |
| XLogP | 7.88 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|